| arheol; (2Z)-5-{2,3-dimethyltricyclo[2.2.1.02,6]heptan-3-yl}-2-methylpent-2-en-1-ol; α-santalol; cis-α-santalol | |
| CAS RN: | [115-71-9] |
| Formula: | C15H24O; 220.35 g/mol |
| InChiKey: | PDEQKAVEYSOLJX-YHYXMXQVSA-N |
| SMILES: | C/C(=C/CCC1(C2CC3C1(C3C2)C)C)/CO |
| Use: | the commercial product is used for waxy essences and medicinals |
| Retetion Index: | 1 477 (ZB5MS); 1 493 (ZB5MS) |
| Density: | 0.991 g/mL |
| Molar volume: | 222.5 mL/mol |
| Refractive index: | 1.507 |
| Molecular refractive power: | 66.21 mL/mol |
| Boiling point: | 300 °C |
| 1-adamantyl tert-butyl ketone |
| alloaromadendrene oxide-(1) |
| aromadendrene oxide-(1) |
| aromadendrene oxide-(2) |
| 1-butoxy-4-(2-methylbutan-2-yl)benzene |
| (-)-β-caryophyllene epoxide |
| cedr-8-en-13-ol |
| 2,4-di-tert-butyl-6-methylphenol |
| 2,6-di-tert-butyl-4-methylphenol |
| 1,3-dimethyl-α-ionone |
| 1,3-dimethyl-β-ionone |
| 2,4-ditert-butyl-5-methylphenol |
| farnesal |
| humulene epoxide I |
| humulene epoxide II |
| humulene epoxide III |
| isolongifolanone |
| (1R,4R,7R)-7-isopropyl-2-(1-hydroxy-1-methylethyl)-5-methylbicyclo[2.2.2]octa-2,5-diene |
| lanceol |
| (4E)-3-methyl-5-(2,6,6-trimethylcyclohex-1-en-1-yl)penta-1,4-dien-3-ol |
| 2-nonylphenol |
| 3-nonylphenol |
| 4-nonylphenol |
| α-santalol |
| β-santalol |
| trans-β-santalol |
| (-)-spathulenol |
| spathulenol |
| 2,4,6-tripropylphenol |